| Name | beta-d-glucose pentaacetate |
| Synonyms | Beta-Pentacetylglucose D-b-Glucose pentaacetate β-D-Glucose pentaacetate PENTAACETYL-BETA-D-GLUCOSE beta-d-glucose pentaacetate Pentaacetyl-beta-D-glucopyranose beta-D-Glucopyranosyl pentaacetate PENTA-O-ACETYL-BETA-D-GLUCOPYRANOSE Glucopyranose, pentaacetate, beta-D- 1,2,3,4,6-Penta-O-acetylhexopyranose PENTA-O-ACETYL-BETA-D-GLUCOPYRANOSIDE 1,2,3,4,6-penta-o-acetyl-beta-d-glucopyranose acetyl 2,3,4,6-tetra-o-acetyl-beta-d-glucopyranoside (3xi)-1,2,3,4,6-penta-O-acetyl-beta-D-ribo-hexopyranose |
| CAS | 604-69-3 |
| EINECS | 210-074-8 |
| InChI | InChI=1/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | LPTITAGPBXDDGR-XJGFBQBWSA-N |
| Molecular Formula | C16H22O11 |
| Molar Mass | 390.34 |
| Density | 1,274 g/cm3 |
| Melting Point | 130-132°C |
| Boling Point | 435.58°C (rough estimate) |
| Specific Rotation(α) | 5 º (c=1, CHCl3) |
| Flash Point | 188.1°C |
| Water Solubility | Soluble in chloroform and methanol. Insoluble in water. |
| Solubility | DMSO:78 mg/mL (199.82 mM) |
| Vapor Presure | 9.23E-08mmHg at 25°C |
| Appearance | Powder |
| Color | White to off-white |
| BRN | 98851 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 4.5 ° (C=5, CHCl3) |
| MDL | MFCD00006597 |
| Physical and Chemical Properties | Melting point 129-133°C specific optical rotation 5 ° (c = 1, CHCl3) |
| Risk Codes | R21 - Harmful in contact with skin R36/38 - Irritating to eyes and skin. R46 - May cause heritable genetic damage R62 - Possible risk of impaired fertility R63 - Possible risk of harm to the unborn child |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S53 - Avoid exposure - obtain special instructions before use. S36/37 - Wear suitable protective clothing and gloves. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S25 - Avoid contact with eyes. |
| WGK Germany | 3 |
| HS Code | 29400090 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| biological activity | β-D-glucose pentaacetate is the enantiomer of D-glucose pentaacetate. |